Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(Trifluoroacetyl)tetrahydro-4H-thiopyran-4-one |
|---|---|
| Synonyms | 2-(2,2,2-trifluoroacetyl)dihydro-2H-thiopyran-4(3H)-one |
| Molecular Structure |  |
| Molecular Formula | C7H7F3O2S |
| Molecular Weight | 212.19 |
| CAS Registry Number | 89678-03-5 |
| SMILES | C1CSC(CC1=O)C(=O)C(F)(F)F |
| InChI | 1S/C7H7F3O2S/c8-7(9,10)6(12)5-3-4(11)1-2-13-5/h5H,1-3H2 |
| InChIKey | XOSZVQAPOHOSFQ-UHFFFAOYSA-N |
| Density | 1.414g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.135°C at 760 mmHg (Cal.) |
| Flash point | 119.593°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Trifluoroacetyl)tetrahydro-4H-thiopyran-4-one |