Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Oxatricyclo[3.2.1.02,4]octane-6-sulfonamide |
|---|---|
| Synonyms | 3-oxatricyclo[3.2.1.02,4]octane-6-sulfonamide |
| Molecular Structure | ![CAS#: 89775-87-1， 3-Oxatricyclo[3.2.1.0<sup>2,4</sup>]octane-6-sulfonamide](/moreStructures/89775-87-1.gif) |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.23 |
| CAS Registry Number | 89775-87-1 |
| SMILES | C1C2CC(C1C3C2O3)S(=O)(=O)N |
| InChI | 1S/C7H11NO3S/c8-12(9,10)5-2-3-1-4(5)7-6(3)11-7/h3-7H,1-2H2,(H2,8,9,10) |
| InChIKey | ZYWXAXNQMQBWDJ-UHFFFAOYSA-N |
| Density | 1.559g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.368°C at 760 mmHg (Cal.) |
| Flash point | 182.026°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Oxatricyclo[3.2.1.02,4]octane-6-sulfonamide |