Online Database of Chemicals from Around the World
| Rieke Metals, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (402) 434-2775 | |||
 |
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | Octyl 2-chloroisonicotinate |
|---|---|
| Synonyms | Octyl 2-chloroisonicotinate |
| Molecular Structure |  |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 |
| CAS Registry Number | 898784-94-6 |
| SMILES | O=C(OCCCCCCCC)c1ccnc(Cl)c1 |
| InChI | 1S/C14H20ClNO2/c1-2-3-4-5-6-7-10-18-14(17)12-8-9-16-13(15)11-12/h8-9,11H,2-7,10H2,1H3 |
| InChIKey | MAINPQGFQVXXBP-UHFFFAOYSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.593°C at 760 mmHg (Cal.) |
| Flash point | 172.486°C (Cal.) |
| Refractive index | 1.503 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octyl 2-chloroisonicotinate |