Online Database of Chemicals from Around the World
| Rieke Metals, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (402) 434-2775 | |||
 |
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | 3-(3,5-Dimethoxybenzyl)cyclohexanone |
|---|---|
| Synonyms | 3-(3,5-Dimethoxybenzyl)cyclohexanone |
| Molecular Structure |  |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 |
| CAS Registry Number | 898785-03-0 |
| SMILES | COc1cc(cc(OC)c1)CC2CC(=O)CCC2 |
| InChI | 1S/C15H20O3/c1-17-14-8-12(9-15(10-14)18-2)6-11-4-3-5-13(16)7-11/h8-11H,3-7H2,1-2H3 |
| InChIKey | GZYNVVLQMUBGMD-UHFFFAOYSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.438°C at 760 mmHg (Cal.) |
| Flash point | 179.626°C (Cal.) |
| Refractive index | 1.525 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(3,5-Dimethoxybenzyl)cyclohexanone |