Online Database of Chemicals from Around the World
| Rieke Metals, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (402) 434-2775 | |||
 |
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | 3-(4-Methoxybenzyl)cyclohexanone |
|---|---|
| Synonyms | 3-[(4-Methoxyphenyl)methyl]cyclohexanone |
| Molecular Structure |  |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.29 |
| CAS Registry Number | 898785-44-9 |
| SMILES | COc1ccc(cc1)CC2CC(=O)CCC2 |
| InChI | 1S/C14H18O2/c1-16-14-7-5-11(6-8-14)9-12-3-2-4-13(15)10-12/h5-8,12H,2-4,9-10H2,1H3 |
| InChIKey | HRUCIIVYHABPSG-UHFFFAOYSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.439°C at 760 mmHg (Cal.) |
| Flash point | 150.553°C (Cal.) |
| Refractive index | 1.532 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(4-Methoxybenzyl)cyclohexanone |