Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6,7-Quinoxalinediamine 1-oxide |
|---|---|
| Synonyms | 6,7-diaminoquinoxaline 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 |
| CAS Registry Number | 899449-37-7 |
| SMILES | c1c[n+](c2cc(c(cc2n1)N)N)[O-] |
| InChI | 1S/C8H8N4O/c9-5-3-7-8(4-6(5)10)12(13)2-1-11-7/h1-4H,9-10H2 |
| InChIKey | IXODUHKSWDZJIB-UHFFFAOYSA-N |
| Density | 1.592g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.32°C at 760 mmHg (Cal.) |
| Flash point | 246.104°C (Cal.) |
| Refractive index | 1.771 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7-Quinoxalinediamine 1-oxide |