| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | API >> Synthetic anti-infective drugs >> Sulfonamides and synergists |
|---|---|
| Name | N-(2-Aminoethyl)-4-Bromo-Benzenesulfonamide |
| Synonyms | 2-[(4-Bromophenyl)Sulfonylamino]Ethylammonium; Zinc04369091 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12BrN2O2S |
| Molecular Weight | 280.16 |
| CAS Registry Number | 90002-56-5 |
| SMILES | C1=C(C=CC(=C1)Br)[S](=O)(=O)NCC[NH3+] |
| InChI | 1S/C8H11BrN2O2S/c9-7-1-3-8(4-2-7)14(12,13)11-6-5-10/h1-4,11H,5-6,10H2/p+1 |
| InChIKey | VSTXANIIZJECGG-UHFFFAOYSA-O |
| Boiling point | 394.927°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.645°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-(2-Aminoethyl)-4-Bromo-Benzenesulfonamide |