Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Amino-2-quinoxalinol 1-oxide |
|---|---|
| Synonyms | 2-Quinoxalinol,3-amino-,1-oxide; 3-amino-2-hydroxyquinoxaline 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 90004-24-3 |
| SMILES | c1ccc2c(c1)nc(c([n+]2[O-])O)N |
| InChI | 1S/C8H7N3O2/c9-7-8(12)11(13)6-4-2-1-3-5(6)10-7/h1-4,12H,(H2,9,10) |
| InChIKey | DCXQNFFFKSLKAG-UHFFFAOYSA-N |
| Density | 1.594g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.133°C at 760 mmHg (Cal.) |
| Flash point | 214.542°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-2-quinoxalinol 1-oxide |