Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,3,4,6-Pyridinetetramine 1-oxide |
|---|---|
| Synonyms | 2,3,4,6-Pyridinetetramine, 1-oxide; 2,3,4,6-tetraaminopyridine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C5H9N5O |
| Molecular Weight | 155.16 |
| CAS Registry Number | 900138-72-9 |
| SMILES | c1c(c(c([n+](c1N)[O-])N)N)N |
| InChI | 1S/C5H9N5O/c6-2-1-3(7)10(11)5(9)4(2)8/h1H,6-9H2 |
| InChIKey | LPJWAZRGACIDGO-UHFFFAOYSA-N |
| Density | 1.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 660.792°C at 760 mmHg (Cal.) |
| Flash point | 353.434°C (Cal.) |
| Refractive index | 1.848 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,6-Pyridinetetramine 1-oxide |