Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,4,5,6-Pyridazinetetramine 1-oxide |
|---|---|
| Synonyms | 3,4,5,6-tetraaminopyridazine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C4H8N6O |
| Molecular Weight | 156.15 |
| CAS Registry Number | 900139-35-7 |
| SMILES | c1(c(c([n+](nc1N)[O-])N)N)N |
| InChI | 1S/C4H8N6O/c5-1-2(6)4(8)10(11)9-3(1)7/h5-6,8H2,(H2,7,9) |
| InChIKey | OAGAPSKNQJMWHQ-UHFFFAOYSA-N |
| Density | 2.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 557.103°C at 760 mmHg (Cal.) |
| Flash point | 290.725°C (Cal.) |
| Refractive index | 1.992 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5,6-Pyridazinetetramine 1-oxide |