Online Database of Chemicals from Around the World
|
CAS#: 90053-07-9 Product: 9-oxo-10(9H)-acridinebutanoic acid No suppilers available for the product. |
| Name | 9-oxo-10(9H)-acridinebutanoic acid |
|---|---|
| Synonyms | 4-(9-Oxo-10-Acridinyl)Butanoic Acid; 4-(9-Ketoacridin-10-Yl)Butyric Acid; 10(9H)-Acridinebutanoic Acid, 9-Oxo- |
| Molecular Structure |  |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 |
| CAS Registry Number | 90053-07-9 |
| SMILES | C1=C3C(=CC=C1)N(C2=CC=CC=C2C3=O)CCCC(=O)O |
| InChI | 1S/C17H15NO3/c19-16(20)10-5-11-18-14-8-3-1-6-12(14)17(21)13-7-2-4-9-15(13)18/h1-4,6-9H,5,10-11H2,(H,19,20) |
| InChIKey | QXMSWLUVAGUMQV-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 514.705°C at 760 mmHg (Cal.) |
| Flash point | 265.085°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-oxo-10(9H)-acridinebutanoic acid |