Online Database of Chemicals from Around the World
|
CAS#: 901-56-4 Product: 20-alpha-Dihydropregenolone No suppilers available for the product. |
| Name | 20-alpha-Dihydropregenolone |
|---|---|
| Synonyms | 5-Pregnene-3Beta,20Alpha-Diol; Pregn-5-Ene-3,20-Diol, (3Beta,20S); 20Alpha-Dihydropregnenolone |
| Molecular Structure |  |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 |
| CAS Registry Number | 901-56-4 |
| SMILES | [C@@]34(C)[C@@H]1[C@H]([C@H]2[C@@](CC1)(C)[C@H](CC2)[C@H](C)O)CC=C3C[C@H](CC4)O |
| InChI | 1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4,13,15-19,22-23H,5-12H2,1-3H3/t13-,15-,16-,17+,18-,19-,20-,21+/m0/s1 |
| InChIKey | QAAQQTDJEXMIMF-YZXCLFAISA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.893°C at 760 mmHg (Cal.) |
| Flash point | 198.631°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 20-alpha-Dihydropregenolone |