| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | Polyethylene glycol mono(4-tert-octylphenyl) ether |
|---|---|
| Synonyms | 2-[4-(1,1,3,3-Tetramethylbutyl)Phenoxy]Ethanol; Triton X-100 (Tn); 2-(4-(1,1,3,3-Tetramethylbutyl)Phenoxy)Ethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 |
| CAS Registry Number | 9010-43-9 (9077-65-0;63869-93-2;2315-67-5) |
| SMILES | C1=C(C(CC(C)(C)C)(C)C)C=CC(=C1)OCCO |
| InChI | 1S/C16H26O2/c1-15(2,3)12-16(4,5)13-6-8-14(9-7-13)18-11-10-17/h6-9,17H,10-12H2,1-5H3 |
| InChIKey | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 1.061 (Expl.) | |
| Melting point | 5°C (Expl.) |
| Boiling point | 250°C (Expl.) |
| 351.2±25.0°C at 760 mmHg (Cal.) | |
| Flash point | 180°C (Expl.) |
| 136.6±17.4°C (Cal.) | |
| Refractive index | 1.49 (Expl.) |
| Safety Code | S26;S36;S60;S61 Details |
|---|---|
| Risk Code | R22;R36;R52/53 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates skin and eyes, harmful if swallowed |
| WARNING: Risk of serious damage to eyes. | |
| Market Analysis Reports |
| List of Reports Available for Polyethylene glycol mono(4-tert-octylphenyl) ether |