Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Nitrosobenzenesulfonamide |
|---|---|
| Synonyms | 3-nitrosobenzenesulfonamide |
| Molecular Structure |  |
| Molecular Formula | C6H6N2O3S |
| Molecular Weight | 186.19 |
| CAS Registry Number | 90109-75-4 |
| SMILES | c1cc(cc(c1)S(=O)(=O)N)N=O |
| InChI | 1S/C6H6N2O3S/c7-12(10,11)6-3-1-2-5(4-6)8-9/h1-4H,(H2,7,10,11) |
| InChIKey | SNRIZLHEXFUCQZ-UHFFFAOYSA-N |
| Density | 1.556g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.531°C at 760 mmHg (Cal.) |
| Flash point | 204.501°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Nitrosobenzenesulfonamide |