Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl 3-(sulfamoylamino)benzoate |
|---|---|
| Synonyms | ethyl 3-(sulfamoylamino)benzoate |
| Molecular Structure |  |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 |
| CAS Registry Number | 901144-40-9 |
| SMILES | CCOC(=O)c1cccc(c1)NS(=O)(=O)N |
| InChI | 1S/C9H12N2O4S/c1-2-15-9(12)7-4-3-5-8(6-7)11-16(10,13)14/h3-6,11H,2H2,1H3,(H2,10,13,14) |
| InChIKey | OHQFEEHCDAHVNF-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.179°C at 760 mmHg (Cal.) |
| Flash point | 203.684°C (Cal.) |
| Refractive index | 1.599 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(sulfamoylamino)benzoate |