| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Catalysts and additives >> Polymer |
|---|---|
| Name | Poly(Vinyltoluene-Co-alpha-Methylstyrene) |
| Synonyms | Isopropenylbenzene; 1-Methyl-2-Vinyl-Benzene; Isopropenylbenzene; 1-Methyl-2-Vinylbenzene; 1-Ethenyl-2-Methyl-Benzene; Prop-1-En-2-Ylbenzene |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 |
| CAS Registry Number | 9017-27-0 |
| SMILES | C1=C(C(=CC=C1)C)C=C.C2=C(C(=C)C)C=CC=C2 |
| InChI | 1S/2C9H10/c1-8(2)9-6-4-3-5-7-9;1-3-9-7-5-4-6-8(9)2/h2*3-7H,1H2,2H3 |
| InChIKey | OSBCHXNIHVRZCO-UHFFFAOYSA-N |
| Boiling point | 169.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 44.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Poly(Vinyltoluene-Co-alpha-Methylstyrene) |