Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,3-Dimethylfuro[3,4-b]pyrazine-5,7-dione |
|---|---|
| Synonyms | 2,3-dimethylfuro[3,4-b]pyrazine-5,7-dione |
| Molecular Structure | ![CAS#: 90196-41-1， 2,3-Dimethylfuro[3,4-b]pyrazine-5,7-dione](/moreStructures/90196-41-1.gif) |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.14 |
| CAS Registry Number | 90196-41-1 |
| SMILES | Cc1c(nc2c(n1)C(=O)OC2=O)C |
| InChI | 1S/C8H6N2O3/c1-3-4(2)10-6-5(9-3)7(11)13-8(6)12/h1-2H3 |
| InChIKey | DEZSSEMIAAKOGT-UHFFFAOYSA-N |
| Density | 1.465g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.298°C at 760 mmHg (Cal.) |
| Flash point | 187.427°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethylfuro[3,4-b]pyrazine-5,7-dione |