|
CAS#: 902836-20-8 Product: 2-Methyl-2-propanyl 3-(3-methylphenoxy)-1-piperidinecarboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 3-(3-methylphenoxy)-1-piperidinecarboxylate |
|---|---|
| Synonyms | 3-M-TolYl-Oxy-Piperidine-1-Carboxylic Acid Tert-Butyl Ester; tert-butyl 4-(m-tolyloxy)piperidine-1-carboxylate; MFCD07368320 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 |
| CAS Registry Number | 902836-20-8 |
| SMILES | Cc1cccc(c1)OC2CCCN(C2)C(=O)OC(C)(C)C |
| InChI | 1S/C17H25NO3/c1-13-7-5-8-14(11-13)20-15-9-6-10-18(12-15)16(19)21-17(2,3)4/h5,7-8,11,15H,6,9-10,12H2,1-4H3 |
| InChIKey | NNJZUDMDBWMSQB-UHFFFAOYSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.554°C at 760 mmHg (Cal.) |
| Flash point | 192.42°C (Cal.) |
| Refractive index | 1.522 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 3-(3-methylphenoxy)-1-piperidinecarboxylate |