Online Database of Chemicals from Around the World
|
CAS#: 90370-14-2 Product: 6-Methylangelicin No suppilers available for the product. |
| Name | 6-Methylangelicin |
|---|---|
| Synonyms | 6-Methyl-2-Furo[2,3-H]Chromenone; 2H-Furo(2,3-H)-1-Benzopyran-2-One, 6-Methyl-; 6-Methylangelicin |
| Molecular Structure |  |
| Molecular Formula | C12H8O3 |
| Molecular Weight | 200.19 |
| CAS Registry Number | 90370-14-2 |
| SMILES | C3=C1C=CC(=O)OC1=C2C=COC2=C3C |
| InChI | 1S/C12H8O3/c1-7-6-8-2-3-10(13)15-12(8)9-4-5-14-11(7)9/h2-6H,1H3 |
| InChIKey | PFVGXOYZQOJGGR-UHFFFAOYSA-N |
| Density | 1.332g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.929°C at 760 mmHg (Cal.) |
| Flash point | 178.737°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methylangelicin |