Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Methyl 4-(3-pyridinyl)benzoate |
|---|---|
| Synonyms | methyl 4-(pyridin-3-yl)benzoate; METHYL4-(3-PYRIDINYL)BENZOATE; methyl-4-(pyridin-3-yl)benzoate |
| Molecular Structure |  |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23 |
| CAS Registry Number | 90395-47-4 |
| SMILES | O=C(OC)c2ccc(c1cccnc1)cc2 |
| InChI | 1S/C13H11NO2/c1-16-13(15)11-6-4-10(5-7-11)12-3-2-8-14-9-12/h2-9H,1H3 |
| InChIKey | SMXKPSLCRALELV-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.761°C at 760 mmHg (Cal.) |
| Flash point | 170.168°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-(3-pyridinyl)benzoate |