|
CAS#: 90415-17-1 Product: 5,7-Dibromo-benzofuran-2-carboxylic acid No suppilers available for the product. |
| Name | 5,7-Dibromo-benzofuran-2-carboxylic acid |
|---|---|
| Synonyms | 5,7-Dibromobenzofuran-2-Carboxylate; 5,7-Dibromo-2-Benzofurancarboxylate; Zinc03884946 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H3Br2O3 |
| Molecular Weight | 318.93 |
| CAS Registry Number | 90415-17-1 |
| SMILES | C1=C(OC2=C(Br)C=C(Br)C=C12)C([O-])=O |
| InChI | 1S/C9H4Br2O3/c10-5-1-4-2-7(9(12)13)14-8(4)6(11)3-5/h1-3H,(H,12,13)/p-1 |
| InChIKey | PTCVMMBMRYJVFE-UHFFFAOYSA-M |
| Boiling point | 418.435°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 206.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7-Dibromo-benzofuran-2-carboxylic acid |