|
CAS#: 90474-20-7 Product: 2,4-Dibromo-13-methyl-6,7,8,9,11,12,13,14,15,16-decahydrospiro[cyclopenta[a]phenanthrene-17,2'-[1,3]dioxolane]-3,16-diol No suppilers available for the product. |
| Name | 2,4-Dibromo-13-methyl-6,7,8,9,11,12,13,14,15,16-decahydrospiro[cyclopenta[a]phenanthrene-17,2'-[1,3]dioxolane]-3,16-diol |
|---|---|
| Synonyms | 2,4-Dibro |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24Br2O4 |
| Molecular Weight | 488.21 |
| CAS Registry Number | 90474-20-7 |
| SMILES | CC12CCC3c4cc(c(c(c4CCC3C1CC(C25OCCO5)O)Br)O)Br |
| InChI | 1S/C20H24Br2O4/c1-19-5-4-10-11(14(19)9-16(23)20(19)25-6-7-26-20)2-3-12-13(10)8-15(21)18(24)17(12)22/h8,10-11,14,16,23-24H,2-7,9H2,1H3 |
| InChIKey | GUKVLVMQIYQXIM-UHFFFAOYSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.5±50.0°C at 760 mmHg (Cal.) |
| Flash point | 276.5±30.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dibromo-13-methyl-6,7,8,9,11,12,13,14,15,16-decahydrospiro[cyclopenta[a]phenanthrene-17,2'-[1,3]dioxolane]-3,16-diol |