Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1-(5-Chloro-2-hydroxy-3-nitrophenyl)-1-propanone |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.62 |
| CAS Registry Number | 90537-41-0 |
| SMILES | CCC(=O)c1cc(cc(c1O)[N+](=O)[O-])Cl |
| InChI | 1S/C9H8ClNO4/c1-2-8(12)6-3-5(10)4-7(9(6)13)11(14)15/h3-4,13H,2H2,1H3 |
| InChIKey | SANYDHDAOAMYKV-UHFFFAOYSA-N |
| Density | 1.438g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.632°C at 760 mmHg (Cal.) |
| Flash point | 121.708°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(5-Chloro-2-hydroxy-3-nitrophenyl)-1-propanone |