Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1,2,3,4-Tetrahydro-2-quinoxalinecarboxamide |
|---|---|
| Synonyms | Nciopen2_001368; Nsc90837 |
| Molecular Structure |  |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 |
| CAS Registry Number | 90559-19-6 |
| SMILES | C1=CC=CC2=C1NC(CN2)C(=O)N |
| InChI | 1S/C9H11N3O/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-4,8,11-12H,5H2,(H2,10,13) |
| InChIKey | XUUYVFJOLKENPD-UHFFFAOYSA-N |
| Density | 1.208g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.568°C at 760 mmHg (Cal.) |
| Flash point | 240.81°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-Tetrahydro-2-quinoxalinecarboxamide |