Online Database of Chemicals from Around the World
| Sinova Corporation | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (301) 961-1525 | |||
 |
sales@sinovainc.com | |||
| Chemical manufacturer | ||||
| Name | 4-Ethoxycarbonyl-3-methylpyrrol-2-carboxylic acid |
|---|---|
| Synonyms | 4-Carbethoxy-3-Methyl-1H-Pyrrole-2-Carboxylic Acid; Nsc16662 |
| Molecular Structure |  |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 |
| CAS Registry Number | 90610-58-5 |
| SMILES | C1=C(C(=C(C(O)=O)[NH]1)C)C(OCC)=O |
| InChI | 1S/C9H11NO4/c1-3-14-9(13)6-4-10-7(5(6)2)8(11)12/h4,10H,3H2,1-2H3,(H,11,12) |
| InChIKey | WGGWAQNTAWYBFA-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.734°C at 760 mmHg (Cal.) |
| Flash point | 218.534°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethoxycarbonyl-3-methylpyrrol-2-carboxylic acid |