Online Database of Chemicals from Around the World
|
CAS#: 90660-21-2 Product: 4,4-Difluororetinol No suppilers available for the product. |
| Name | 4,4-Difluororetinol |
|---|---|
| Synonyms | (2Z,4E,6Z,8E)-9-(3,3-Difluoro-2,6,6-Trimethyl-1-Cyclohexenyl)-3,7-Dimethyl-Nona-2,4,6,8-Tetraen-1-Ol; 4,4-Difluororetinyl Acetate; Retinol, 4,4-Difluoro-, (5'Alpha,10Alpha)- |
| Molecular Structure |  |
| Molecular Formula | C20H28F2O |
| Molecular Weight | 322.44 |
| CAS Registry Number | 90660-21-2 (90660-22-3) |
| SMILES | C(O)/C=C(\C=C\C=C(/C=C/C1=C(C(F)(F)CCC1(C)C)C)C)C |
| InChI | 1S/C20H28F2O/c1-15(7-6-8-16(2)11-14-23)9-10-18-17(3)20(21,22)13-12-19(18,4)5/h6-11,23H,12-14H2,1-5H3/b8-6+,10-9+,15-7-,16-11- |
| InChIKey | CCXJNLIAIULEDQ-SQBKUCFKSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.922°C at 760 mmHg (Cal.) |
| Flash point | 205.343°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Difluororetinol |