Online Database of Chemicals from Around the World
|
CAS#: 90663-63-1 Product: 3-(4-Acetyl-5-methyl-1H-pyrrol-3-yl)propanoic acid No suppilers available for the product. |
| Name | 3-(4-Acetyl-5-methyl-1H-pyrrol-3-yl)propanoic acid |
|---|---|
| Synonyms | 3-(4-Acetyl-5-Methyl-1H-Pyrrol-3-Yl)Propionic Acid; 3-(4-Ethanoyl-5-Methyl-1H-Pyrrol-3-Yl)Propanoic Acid; 1H-Pyrrole-3-Propanoic Acid, 4-Acetyl-5-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 |
| CAS Registry Number | 90663-63-1 |
| SMILES | C1=C(C(=C([NH]1)C)C(=O)C)CCC(=O)O |
| InChI | 1S/C10H13NO3/c1-6-10(7(2)12)8(5-11-6)3-4-9(13)14/h5,11H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | PNZIZPJYPBTHTM-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.487°C at 760 mmHg (Cal.) |
| Flash point | 194.194°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Acetyl-5-methyl-1H-pyrrol-3-yl)propanoic acid |