Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 3-(chlorocarbonyl)-2,2-dimethylcyclobutanecarboxylate |
|---|---|
| Synonyms | methyl 3-(chlorocarbonyl)-2,2-dimethylcyclobutanecarboxylate |
| Molecular Structure |  |
| Molecular Formula | C9H13ClO3 |
| Molecular Weight | 204.65 |
| CAS Registry Number | 90675-51-7 |
| SMILES | CC1(C(CC1C(=O)Cl)C(=O)OC)C |
| InChI | 1S/C9H13ClO3/c1-9(2)5(7(10)11)4-6(9)8(12)13-3/h5-6H,4H2,1-3H3 |
| InChIKey | HCZSKQRYJCZNOL-UHFFFAOYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 228.549°C at 760 mmHg (Cal.) |
| Flash point | 84.42°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-(chlorocarbonyl)-2,2-dimethylcyclobutanecarboxylate |