Online Database of Chemicals from Around the World
|
CAS#: 90724-44-0 Product: 3-Methoxypyridinium chloride No suppilers available for the product. |
| Name | 3-Methoxypyridinium chloride |
|---|---|
| Synonyms | 3-Methoxypyridinium Chloride |
| Molecular Structure |  |
| Molecular Formula | C6H8ClNO |
| Molecular Weight | 145.59 |
| CAS Registry Number | 90724-44-0 |
| EINECS | 292-677-6 |
| SMILES | C1=C(OC)C=CC=[NH+]1.[Cl-] |
| InChI | 1S/C6H7NO.ClH/c1-8-6-3-2-4-7-5-6;/h2-5H,1H3;1H |
| InChIKey | HIADZSOBMPSUGZ-UHFFFAOYSA-N |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxypyridinium chloride |