Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 5-Cyano-1,2,5-trimethylprolinamide |
|---|---|
| Synonyms | 5-cyano-1,2,5-trimethylpyrrolidine-2-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.23 |
| CAS Registry Number | 90768-60-8 |
| SMILES | CC1(CCC(N1C)(C)C(=O)N)C#N |
| InChI | 1S/C9H15N3O/c1-8(6-10)4-5-9(2,7(11)13)12(8)3/h4-5H2,1-3H3,(H2,11,13) |
| InChIKey | IXCYBZCNYMLAJA-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.588°C at 760 mmHg (Cal.) |
| Flash point | 171.273°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Cyano-1,2,5-trimethylprolinamide |