Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Aminocyclohepta[b]pyrrole-3-carboxylic acid |
|---|---|
| Synonyms | 2-aminocyclohepta[b]pyrrole-3-carboxylic acid |
| Molecular Structure | ![CAS#: 90770-92-6， 2-Aminocyclohepta[b]pyrrole-3-carboxylic acid](/moreStructures/90770-92-6.gif) |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18 |
| CAS Registry Number | 90770-92-6 |
| SMILES | c1ccc-2c(c(nc2cc1)N)C(=O)O |
| InChI | 1S/C10H8N2O2/c11-9-8(10(13)14)6-4-2-1-3-5-7(6)12-9/h1-5H,(H2,11,12)(H,13,14) |
| InChIKey | GBCOBUVQXBTMIJ-UHFFFAOYSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.488°C at 760 mmHg (Cal.) |
| Flash point | 286.725°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Aminocyclohepta[b]pyrrole-3-carboxylic acid |