Online Database of Chemicals from Around the World
|
CAS#: 908334-02-1 Product: 4'-Bromo-7'-methyl-2',3'-dihydrospiro[1,3-dioxolane-2,1'-indene] No suppilers available for the product. |
| Name | 4'-Bromo-7'-methyl-2',3'-dihydrospiro[1,3-dioxolane-2,1'-indene] |
|---|---|
| Synonyms | 4-Bromo-7-methyl-1,1-(ethylenedioxo)-indane |
| Molecular Structure | ![CAS#: 908334-02-1， 4'-Bromo-7'-methyl-2',3'-dihydrospiro[1,3-dioxolane-2,1'-indene]](/moreStructures/908334-02-1.gif) |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.13 |
| CAS Registry Number | 908334-02-1 |
| SMILES | Cc1ccc(c2c1C3(CC2)OCCO3)Br |
| InChI | 1S/C12H13BrO2/c1-8-2-3-10(13)9-4-5-12(11(8)9)14-6-7-15-12/h2-3H,4-7H2,1H3 |
| InChIKey | ZMSHXGCHJNAZTJ-UHFFFAOYSA-N |
| Density | 1.528g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.394°C at 760 mmHg (Cal.) |
| Flash point | 159.155°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Bromo-7'-methyl-2',3'-dihydrospiro[1,3-dioxolane-2,1'-indene] |