|
CAS#: 908334-05-4 Product: 4'-Bromo-2',3'-dihydrospiro[1,3-dioxane-2,1'-indene] No suppilers available for the product. |
| Name | 4'-Bromo-2',3'-dihydrospiro[1,3-dioxane-2,1'-indene] |
|---|---|
| Synonyms | 4-Bromo-1,1-(propylenedioxo)-indane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.13 |
| CAS Registry Number | 908334-05-4 |
| SMILES | c1cc2c(c(c1)Br)CCC23OCCCO3 |
| InChI | 1S/C12H13BrO2/c13-11-4-1-3-10-9(11)5-6-12(10)14-7-2-8-15-12/h1,3-4H,2,5-8H2 |
| InChIKey | ZNZMJQVYWVDCLZ-UHFFFAOYSA-N |
| Density | 1.524g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.941°C at 760 mmHg (Cal.) |
| Flash point | 166.351°C (Cal.) |
| Refractive index | 1.615 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Bromo-2',3'-dihydrospiro[1,3-dioxane-2,1'-indene] |