|
CAS#: 90841-06-8 Product: 2-[(2,4-Dinitrophenyl)amino]-2-methylpropanoic acid No suppilers available for the product. |
| Name | 2-[(2,4-Dinitrophenyl)amino]-2-methylpropanoic acid |
|---|---|
| Synonyms | 2-[(2,4-Dinitrophenyl)Amino]-2-Methyl-Propanoic Acid; 2-[(2,4-Dinitrophenyl)Amino]-2-Methyl-Propionic Acid; Nsc97895 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O6 |
| Molecular Weight | 269.21 |
| CAS Registry Number | 90841-06-8 |
| SMILES | C1=C([N+](=O)[O-])C=CC(=C1[N+](=O)[O-])NC(C(O)=O)(C)C |
| InChI | 1S/C10H11N3O6/c1-10(2,9(14)15)11-7-4-3-6(12(16)17)5-8(7)13(18)19/h3-5,11H,1-2H3,(H,14,15) |
| InChIKey | TXMJURUNBSYXRI-UHFFFAOYSA-N |
| Density | 1.523g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.922°C at 760 mmHg (Cal.) |
| Flash point | 256.144°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2,4-Dinitrophenyl)amino]-2-methylpropanoic acid |