|
CAS#: 90919-34-9 Product: 3-(4-Chlorophenylthio)butyric acid No suppilers available for the product. |
| Name | 3-(4-Chlorophenylthio)butyric acid |
|---|---|
| Synonyms | (3S)-3-[(4-Chlorophenyl)Thio]Butanoate; (3S)-3-[(4-Chlorophenyl)Thio]Butyrate; Zinc05211284 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClO2S |
| Molecular Weight | 229.70 |
| CAS Registry Number | 90919-34-9 |
| SMILES | [C@@H](SC1=CC=C(Cl)C=C1)(CC([O-])=O)C |
| InChI | 1S/C10H11ClO2S/c1-7(6-10(12)13)14-9-4-2-8(11)3-5-9/h2-5,7H,6H2,1H3,(H,12,13)/p-1/t7-/m0/s1 |
| InChIKey | DSCJEDOCSCNYAI-ZETCQYMHSA-M |
| Boiling point | 374.202°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 180.111°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(4-Chlorophenylthio)butyric acid |