Online Database of Chemicals from Around the World
|
CAS#: 90920-73-3 Product: 6-Thioguainine disulfide No suppilers available for the product. |
| Name | 6-Thioguainine disulfide |
|---|---|
| Synonyms | [6-[(2-Amino-7H-Purin-6-Yl)Disulfanyl]-7H-Purin-2-Yl]Amine; 6-Thioguainine Disulfide; 6-Thioguanine Disulphide |
| Molecular Structure |  |
| Molecular Formula | C10H8N10S2 |
| Molecular Weight | 332.36 |
| CAS Registry Number | 90920-73-3 |
| SMILES | C1=NC2=C([NH]1)C(=NC(=N2)N)SSC3=NC(=NC4=C3[NH]C=N4)N |
| InChI | 1S/C10H8N10S2/c11-9-17-5-3(13-1-15-5)7(19-9)21-22-8-4-6(16-2-14-4)18-10(12)20-8/h1-2H,(H3,11,13,15,17,19)(H3,12,14,16,18,20) |
| InChIKey | JPJJKOHKFJJKTP-UHFFFAOYSA-N |
| Density | 1.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 1042.602°C at 760 mmHg (Cal.) |
| Flash point | 584.344°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Thioguainine disulfide |