Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 5,6-dihydroxy-2-indolinecarboxylate |
|---|---|
| Synonyms | methyl 5,6-dihydroxyindoline-2-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 90922-83-1 |
| SMILES | COC(=O)C1Cc2cc(c(cc2N1)O)O |
| InChI | 1S/C10H11NO4/c1-15-10(14)7-2-5-3-8(12)9(13)4-6(5)11-7/h3-4,7,11-13H,2H2,1H3 |
| InChIKey | JQFIYBUMSYATMC-UHFFFAOYSA-N |
| Density | 1.404g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.82°C at 760 mmHg (Cal.) |
| Flash point | 206.49°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 5,6-dihydroxy-2-indolinecarboxylate |