Online Database of Chemicals from Around the World
|
CAS#: 90937-07-8 Product: 11-Bromomethylestradiol No suppilers available for the product. |
| Name | 11-Bromomethylestradiol |
|---|---|
| Synonyms | 11-Bromomethylestradiol; 11Beta-Bromomethylestradiol; Estra-1,3,5(10)-Triene-3,17-Diol, 11-(Bromomethyl)-, (11Beta,17Beta)- |
| Molecular Structure |  |
| Molecular Formula | C19H25BrO2 |
| Molecular Weight | 365.31 |
| CAS Registry Number | 90937-07-8 |
| SMILES | [C@@H]23CCC1=C(C=CC(=C1)O)[C@H]2[C@H](C[C@]4([C@H]3CC[C@@H]4O)C)CBr |
| InChI | 1S/C19H25BrO2/c1-19-9-12(10-20)18-14-5-3-13(21)8-11(14)2-4-15(18)16(19)6-7-17(19)22/h3,5,8,12,15-18,21-22H,2,4,6-7,9-10H2,1H3/t12-,15+,16+,17+,18-,19+/m1/s1 |
| InChIKey | UNCKJYTUPIOIRJ-OQFXVXKWSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 506.024°C at 760 mmHg (Cal.) |
| Flash point | 259.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Bromomethylestradiol |