Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (571) 8708-6220 | |||
|
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | (3R)-3-Amino-3-(3,4-dichlorophenyl)propanoic acid |
|---|---|
| Synonyms | R-3-Amino-3-(3,4-dichloro-phenyl)-propionic acid; TL80073926; ZINC00054332 |
| Molecular Structure |  |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 |
| CAS Registry Number | 909709-44-0 |
| SMILES | Clc1ccc(cc1Cl)[C@H](N)CC(=O)O |
| InChI | 1S/C9H9Cl2NO2/c10-6-2-1-5(3-7(6)11)8(12)4-9(13)14/h1-3,8H,4,12H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | ACJWNKAQMZQVBW-MRVPVSSYSA-N |
| Density | 1.448g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.936°C at 760 mmHg (Cal.) |
| Flash point | 178.741°C (Cal.) |
| Refractive index | 1.6 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-3-Amino-3-(3,4-dichlorophenyl)propanoic acid |