|
CAS#: 910442-25-0 Product: 3-(3-Bromophenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,2]oxazole 5,5-dioxide No suppilers available for the product. |
| Name | 3-(3-Bromophenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,2]oxazole 5,5-dioxide |
|---|---|
| Synonyms | 3-(3-Brom |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.17 |
| CAS Registry Number | 910442-25-0 |
| SMILES | c1cc(cc(c1)Br)C2=NOC3C2CS(=O)(=O)C3 |
| InChI | 1S/C11H10BrNO3S/c12-8-3-1-2-7(4-8)11-9-5-17(14,15)6-10(9)16-13-11/h1-4,9-10H,5-6H2 |
| InChIKey | AAMNIIBHGHTALO-UHFFFAOYSA-N |
| Density | 1.879g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.592°C at 760 mmHg (Cal.) |
| Flash point | 260.783°C (Cal.) |
| Refractive index | 1.732 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3-Bromophenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,2]oxazole 5,5-dioxide |