Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Astatech, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (215) 785-3197 | |||
|
sales@astatechinc.com | |||
| Chemical manufacturer since 1996 | ||||
| Name | 3-Amino-2-[2-(trifluoromethoxy)benzyl]propanoic acid |
|---|---|
| Synonyms | 2-Aminomethyl-3-(2-; 2-Aminomethyl-3-(2-trifluoromethoxyphenyl)propionic acid; 2-Aminomethyl-3-(2-trifluoromethoxy-phenyl)-propionic acid |
| Molecular Structure | ![CAS#: 910443-92-4， 3-Amino-2-[2-(trifluoromethoxy)benzyl]propanoic acid](/moreStructures/910443-92-4.gif) |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.21 |
| CAS Registry Number | 910443-92-4 |
| SMILES | FC(F)(F)Oc1ccccc1CC(CN)C(O)=O |
| InChI | 1S/C11H12F3NO3/c12-11(13,14)18-9-4-2-1-3-7(9)5-8(6-15)10(16)17/h1-4,8H,5-6,15H2,(H,16,17) |
| InChIKey | YCHQBHGFEJYTRV-UHFFFAOYSA-N |
| Density | 1.354g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.757°C at 760 mmHg (Cal.) |
| Flash point | 146.579°C (Cal.) |
| Refractive index | 1.501 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-2-[2-(trifluoromethoxy)benzyl]propanoic acid |