Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(Chloroacetyl)-1-indanone |
|---|---|
| Synonyms | 1-Indanone, 2-(chloroacetyl)-; 2-(2-chloroacetyl)-2,3-dihydro-1H-inden-1-one |
| Molecular Structure |  |
| Molecular Formula | C11H9ClO2 |
| Molecular Weight | 208.64 |
| CAS Registry Number | 91063-83-1 |
| SMILES | c1ccc2c(c1)CC(C2=O)C(=O)CCl |
| InChI | 1S/C11H9ClO2/c12-6-10(13)9-5-7-3-1-2-4-8(7)11(9)14/h1-4,9H,5-6H2 |
| InChIKey | MKASNCUEHLYDPA-UHFFFAOYSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.621°C at 760 mmHg (Cal.) |
| Flash point | 148.073°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Chloroacetyl)-1-indanone |