|
CAS#: 91180-98-2 Product: N-Ethyl-3,4-Dihydro-2H-1,4-Benzoxazine-2-Carboxamide Hydrochloride No suppilers available for the product. |
| Name | N-Ethyl-3,4-Dihydro-2H-1,4-Benzoxazine-2-Carboxamide Hydrochloride |
|---|---|
| Synonyms | Zinc03888987 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 91180-98-2 |
| SMILES | [C@@H]2(OC1=CC=CC=C1NC2)C(=O)NCC |
| InChI | 1S/C11H14N2O2/c1-2-12-11(14)10-7-13-8-5-3-4-6-9(8)15-10/h3-6,10,13H,2,7H2,1H3,(H,12,14)/t10-/m0/s1 |
| InChIKey | CGLUMNSSONIHGR-JTQLQIEISA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.572°C at 760 mmHg (Cal.) |
| Flash point | 223.274°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-3,4-Dihydro-2H-1,4-Benzoxazine-2-Carboxamide Hydrochloride |