Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 1,2,3,5-Tetraphenylbenzene |
|---|---|
| Synonyms | 1,2,3,5-Tetraphenylbenzene; Nsc106322 |
| Molecular Structure |  |
| Molecular Formula | C30H22 |
| Molecular Weight | 382.50 |
| CAS Registry Number | 912-61-8 |
| SMILES | C1=CC=CC=C1C3=CC(=C(C2=CC=CC=C2)C(=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
| InChI | 1S/C30H22/c1-5-13-23(14-6-1)27-21-28(24-15-7-2-8-16-24)30(26-19-11-4-12-20-26)29(22-27)25-17-9-3-10-18-25/h1-22H |
| InChIKey | SKTCWUHHHPSBCJ-UHFFFAOYSA-N |
| Density | 1.091g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.914°C at 760 mmHg (Cal.) |
| Flash point | 252.636°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,5-Tetraphenylbenzene |