| NANJING DAOGE BIOPHARMA CO., LTD. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.daogepharm.com | |||
![]() | +86 18021503536 | |||
![]() | sale@daogepharm.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | 3-Pyrrolidin-1-ylmethyl-benzylamine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.28 |
| CAS Registry Number | 91271-78-2 |
| EC Number | 862-945-2 |
| SMILES | C1CCN(C1)CC2=CC=CC(=C2)CN |
| Solubility | 1.789e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.584, Calc.* |
| Melting point | 87.89 °C |
| Boiling Point | 303.26 °C, 295.0±20.0 °C (760 mmHg), Calc.* |
| Flash Point | 120.2±16.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H312-H314-H332-H335 Details | ||||||||||||||||||||||||
| Safety Statements | P260-P261-P264-P270-P271-P280-P301+P317-P301+P330+P331-P302+P352-P302+P361+P354-P304+P340-P305+P354+P338-P316-P317-P319-P321-P330-P362+P364-P363-P403+P233-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 3-Pyrrolidin-1-ylmethyl-benzylamine |