Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-(2-Fluorophenyl)-1H-imidazole |
|---|---|
| Synonyms | 1H-Imidazole, 5-(2-fluorophenyl)-; 5-(2-fluorophenyl)-1H-imidazole |
| Molecular Structure |  |
| Molecular Formula | C9H7FN2 |
| Molecular Weight | 162.16 |
| CAS Registry Number | 912763-52-1 |
| SMILES | C1=CC=C(C(=C1)C2=CNC=N2)F |
| InChI | 1S/C9H7FN2/c10-8-4-2-1-3-7(8)9-5-11-6-12-9/h1-6H,(H,11,12) |
| InChIKey | PXQYPFPWPCQOTB-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.0±17.0°C at 760 mmHg (Cal.) |
| Flash point | 175.2±20.9°C (Cal.) |
| Refractive index | 1.579 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Fluorophenyl)-1H-imidazole |