Online Database of Chemicals from Around the World
| Activate Scientific GmbH | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 (8051) 965-1660 | |||
 |
rschmitt@activate-scientific.com | |||
| Chemical manufacturer | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | 4-Isopropyl-2-(pentafluoroethyl)-5-pyrimidinecarboxylic acid |
|---|---|
| Synonyms | 4-Isopropyl-2-pentafluoro ethyl-pyrimidine-5-carboxylic acid; 4-Isopropyl-5-pentafluoro-pyrimidine-5-carboxylic acid |
| Molecular Structure |  |
| Molecular Formula | C10H9F5N2O2 |
| Molecular Weight | 284.18 |
| CAS Registry Number | 914201-16-4 |
| SMILES | FC(F)(c1nc(C(C)C)c(cn1)C(O)=O)C(F)(F)F |
| InChI | 1S/C10H9F5N2O2/c1-4(2)6-5(7(18)19)3-16-8(17-6)9(11,12)10(13,14)15/h3-4H,1-2H3,(H,18,19) |
| InChIKey | DUOWWEAVVNTNLQ-UHFFFAOYSA-N |
| Density | 1.425g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.83°C at 760 mmHg (Cal.) |
| Flash point | 115.78°C (Cal.) |
| Refractive index | 1.448 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Isopropyl-2-(pentafluoroethyl)-5-pyrimidinecarboxylic acid |