Online Database of Chemicals from Around the World
|
CAS#: 91531-30-5 Product: A 10 No suppilers available for the product. |
| Name | A 10 |
|---|---|
| Synonyms | N-[(3S)-2,6-Dioxo-3-Piperidyl]-2-Phenyl-Acetamide; N-[(3S)-2,6-Dioxo-3-Piperidinyl]-2-Phenylacetamide; N-[(3S)-2,6-Diketo-3-Piperidyl]-2-Phenyl-Acetamide |
| Molecular Structure |  |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 |
| CAS Registry Number | 91531-30-5 |
| SMILES | [C@@H]2(NC(=O)CC1=CC=CC=C1)C(=O)NC(=O)CC2 |
| InChI | 1S/C13H14N2O3/c16-11-7-6-10(13(18)15-11)14-12(17)8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,14,17)(H,15,16,18)/t10-/m0/s1 |
| InChIKey | OQGRFQCUGLKSAV-JTQLQIEISA-N |
| Density | 1.273g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.219°C at 760 mmHg (Cal.) |
| Flash point | 243.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for A 10 |