|
CAS#: 915402-04-9 Product: 4,4,5,5-Tetramethyl-2-(2,3-Dimethyl-4-Methoxyphenyl)-[1,3,2]Dioxaborolane No suppilers available for the product. |
| Name | 4,4,5,5-Tetramethyl-2-(2,3-Dimethyl-4-Methoxyphenyl)-[1,3,2]Dioxaborolane |
|---|---|
| Synonyms | 4-Methoxy-2,3-Dimethylphenylboronic Acid Pinacol Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H23BO3 |
| Molecular Weight | 262.15 |
| CAS Registry Number | 915402-04-9 |
| SMILES | C1=CC(=C(C(=C1B2OC(C(O2)(C)C)(C)C)C)C)OC |
| InChI | 1S/C15H23BO3/c1-10-11(2)13(17-7)9-8-12(10)16-18-14(3,4)15(5,6)19-16/h8-9H,1-7H3 |
| InChIKey | TXIXUBXWDMWIEQ-UHFFFAOYSA-N |
| Density | 1.012g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.668°C at 760 mmHg (Cal.) |
| Flash point | 173.741°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4,4,5,5-Tetramethyl-2-(2,3-Dimethyl-4-Methoxyphenyl)-[1,3,2]Dioxaborolane |