Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 3,4,5,6-Tetrahydroxy-2-Oxo-Hexanoic Acid |
|---|---|
| Synonyms | 3,4,5,6-Tetrahydroxy-2-Oxo-Hexanoic Acid; 3,4,5,6-Tetrahydroxy-2-Keto-Hexanoic Acid |
| Molecular Structure |  |
| Molecular Formula | C6H10O7 |
| Molecular Weight | 194.14 |
| CAS Registry Number | 91548-32-2 |
| EINECS | 211-574-9 |
| SMILES | C(C(C(C(C(=O)C(=O)O)O)O)O)O |
| InChI | 1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-4,7-10H,1H2,(H,12,13) |
| InChIKey | VBUYCZFBVCCYFD-UHFFFAOYSA-N |
| Density | 1.757g/cm3 (Cal.) |
|---|---|
| Boiling point | 550.601°C at 760 mmHg (Cal.) |
| Flash point | 300.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5,6-Tetrahydroxy-2-Oxo-Hexanoic Acid |